C14H19Cl3N2O3S — CID 4105692
2,2,2-trichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide (PubChem CID 4105692) has the molecular formula C14H19Cl3N2O3S and a molecular weight of 401.74 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4105692 |
| Molecular Formula | C14H19Cl3N2O3S |
| Molecular Weight | 401.74 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2,2,2-trichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H19Cl3N2O3S/c1-2-3-4-5-10-18-23(21,22)12-8-6-11(7-9-12)19-13(20)14(15,16)17/h6-9,18H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | TULSPCXYWFMCRZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|