C14H20Cl2N2O3S — CID 3354024
2,2-dichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide (PubChem CID 3354024) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3354024 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2,2-dichloro-N-[4-(hexylsulfamoyl)phenyl]acetamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)C(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H20Cl2N2O3S/c1-2-3-4-5-10-17-22(20,21)12-8-6-11(7-9-12)18-14(19)13(15)16/h6-9,13,17H,2-5,10H2,1H3,(H,18,19) |
| InChIKey | YBJUKZYUBQQZEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|