C19H23IN2O3S — CID 4251063
N-[4-(hexylsulfamoyl)phenyl]-2-iodobenzamide (PubChem CID 4251063) has the molecular formula C19H23IN2O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is N-[4-(hexylsulfamoyl)phenyl]-2-iodobenzamide.
| Compound Name | N-[4-(hexylsulfamoyl)phenyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 4251063 |
| Molecular Formula | C19H23IN2O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | N-[4-(hexylsulfamoyl)phenyl]-2-iodobenzamide |
| SMILES | CCCCCCNS(=O)(=O)c1ccc(NC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C19H23IN2O3S/c1-2-3-4-7-14-21-26(24,25)16-12-10-15(11-13-16)22-19(23)17-8-5-6-9-18(17)20/h5-6,8-13,21H,2-4,7,14H2,1H3,(H,22,23) |
| InChIKey | AHCYDHBPUOPQPE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|