C34H38N4O6S2Se2 — CID 10724138
N-[4-(butylsulfamoyl)phenyl]-2-[[2-[[4-(butylsulfamoyl)phenyl]carbamoyl]phenyl]diselanyl]benzamide (PubChem CID 10724138) has the molecular formula C34H38N4O6S2Se2 and a molecular weight of 820.75 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-2-[[2-[[4-(butylsulfamoyl)phenyl]carbamoyl]phenyl]diselanyl]benzamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-2-[[2-[[4-(butylsulfamoyl)phenyl]carbamoyl]phenyl]diselanyl]benzamide |
|---|---|
| PubChem CID | 10724138 |
| Molecular Formula | C34H38N4O6S2Se2 |
| Molecular Weight | 820.75 g/mol |
| Exact Mass | 822.06 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-2-[[2-[[4-(butylsulfamoyl)phenyl]carbamoyl]phenyl]diselanyl]benzamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NC(=O)c2ccccc2[Se][Se]c2ccccc2C(=O)Nc2ccc(S(=O)(=O)NCCCC)cc2)cc1 |
| InChI | InChI=1S/C34H38N4O6S2Se2/c1-3-5-23-35-45(41,42)27-19-15-25(16-20-27)37-33(39)29-11-7-9-13-31(29)47-48-32-14-10-8-12-30(32)34(40)38-26-17-21-28(22-18-26)46(43,44)36-24-6-4-2/h7-22,35-36H,3-6,23-24H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | OPJMBWPNMCFMRP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.75 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|