C18H21N3O5S — CID 2187430
N-[4-(butylsulfamoyl)phenyl]-2-(2-nitrophenyl)acetamide (PubChem CID 2187430) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2187430 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-2-(2-nitrophenyl)acetamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NC(=O)Cc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-2-3-12-19-27(25,26)16-10-8-15(9-11-16)20-18(22)13-14-6-4-5-7-17(14)21(23)24/h4-11,19H,2-3,12-13H2,1H3,(H,20,22) |
| InChIKey | IZWVYUOVGYRZIL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|