C17H18N4O7S — CID 5052998
N-[4-(butylsulfamoyl)phenyl]-3,5-dinitrobenzamide (PubChem CID 5052998) has the molecular formula C17H18N4O7S and a molecular weight of 422.42 g/mol. Its IUPAC name is N-[4-(butylsulfamoyl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(butylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 5052998 |
| Molecular Formula | C17H18N4O7S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[4-(butylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H18N4O7S/c1-2-3-8-18-29(27,28)16-6-4-13(5-7-16)19-17(22)12-9-14(20(23)24)11-15(10-12)21(25)26/h4-7,9-11,18H,2-3,8H2,1H3,(H,19,22) |
| InChIKey | BRUIRTKYFVVUAU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|