C19H22N4O7S — CID 4929164
N-[4-(dipropylsulfamoyl)phenyl]-3,5-dinitrobenzamide (PubChem CID 4929164) has the molecular formula C19H22N4O7S and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[4-(dipropylsulfamoyl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(dipropylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4929164 |
| Molecular Formula | C19H22N4O7S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[4-(dipropylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H22N4O7S/c1-3-9-21(10-4-2)31(29,30)18-7-5-15(6-8-18)20-19(24)14-11-16(22(25)26)13-17(12-14)23(27)28/h5-8,11-13H,3-4,9-10H2,1-2H3,(H,20,24) |
| InChIKey | QJFPYNPAZMRDNU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|