C22H28N6O6S2 — CID 43948675
4-(dipropylsulfamoyl)-N-[2-[2-[(4-nitrophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 43948675) has the molecular formula C22H28N6O6S2 and a molecular weight of 536.64 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-[2-[2-[(4-nitrophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-[2-[2-[(4-nitrophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 43948675 |
| Molecular Formula | C22H28N6O6S2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-[2-[2-[(4-nitrophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)NCC(=O)NNC(=S)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C22H28N6O6S2/c1-3-13-27(14-4-2)36(33,34)19-11-5-16(6-12-19)21(30)23-15-20(29)25-26-22(35)24-17-7-9-18(10-8-17)28(31)32/h5-12H,3-4,13-15H2,1-2H3,(H,23,30)(H,25,29)(H2,24,26,35) |
| InChIKey | OYTJQBHYEOQABO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|