C15H24N4O4S — CID 43948656
4-(dipropylsulfamoyl)-N-(2-hydrazinyl-2-oxoethyl)benzamide (PubChem CID 43948656) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-(2-hydrazinyl-2-oxoethyl)benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-(2-hydrazinyl-2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 43948656 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-(2-hydrazinyl-2-oxoethyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)NCC(=O)NN)cc1 |
| InChI | InChI=1S/C15H24N4O4S/c1-3-9-19(10-4-2)24(22,23)13-7-5-12(6-8-13)15(21)17-11-14(20)18-16/h5-8H,3-4,9-11,16H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | FSDJPYPGTZLVKE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|