C19H28N4O7S — CID 55304152
[2-oxo-2-(propylcarbamoylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 55304152) has the molecular formula C19H28N4O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55304152 |
| Molecular Formula | C19H28N4O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)CNC(=O)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C19H28N4O7S/c1-4-11-20-19(27)22-16(24)13-30-17(25)12-21-18(26)14-7-9-15(10-8-14)31(28,29)23(5-2)6-3/h7-10H,4-6,11-13H2,1-3H3,(H,21,26)(H2,20,22,24,27) |
| InChIKey | XZCAHBHSWIKWGY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |