C20H31N3O6S — CID 42964227
[2-oxo-2-(pentan-2-ylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 42964227) has the molecular formula C20H31N3O6S and a molecular weight of 441.55 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 42964227 |
| Molecular Formula | C20H31N3O6S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCCC(C)NC(=O)COC(=O)CNC(=O)c1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C20H31N3O6S/c1-5-8-15(4)22-18(24)14-29-19(25)13-21-20(26)16-9-11-17(12-10-16)30(27,28)23(6-2)7-3/h9-12,15H,5-8,13-14H2,1-4H3,(H,21,26)(H,22,24) |
| InChIKey | CGNOKDWLGDQRAC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |