C16H22N2O4 — CID 7783131
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-benzamidoacetate (PubChem CID 7783131) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-benzamidoacetate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 7783131 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 2-benzamidoacetate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-7-12(2)18-14(19)11-22-15(20)10-17-16(21)13-8-5-4-6-9-13/h4-6,8-9,12H,3,7,10-11H2,1-2H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey | ZIOLLSFYZZMSLW-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |