C27H28N2O5 — CID 42962919
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(4-phenoxybenzoyl)amino]acetate (PubChem CID 42962919) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(4-phenoxybenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42962919 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)CNC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O5/c1-20(12-13-21-8-4-2-5-9-21)29-25(30)19-33-26(31)18-28-27(32)22-14-16-24(17-15-22)34-23-10-6-3-7-11-23/h2-11,14-17,20H,12-13,18-19H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | JRFWWOUIPZOLNA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |