C23H30N2O3 — CID 24677699
4-butoxy-N-[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl]benzamide (PubChem CID 24677699) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 4-butoxy-N-[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 24677699 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 4-butoxy-N-[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NC(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H30N2O3/c1-3-4-16-28-21-14-12-20(13-15-21)23(27)24-17-22(26)25-18(2)10-11-19-8-6-5-7-9-19/h5-9,12-15,18H,3-4,10-11,16-17H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | OXEMWRXJSBFZFT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|