C18H28N4O4S — CID 110429162
4-(diethylsulfamoyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide (PubChem CID 110429162) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110429162 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H28N4O4S/c1-4-22(5-2)27(25,26)16-8-6-15(7-9-16)18(24)19-14-17(23)21-12-10-20(3)11-13-21/h6-9H,4-5,10-14H2,1-3H3,(H,19,24) |
| InChIKey | HEYJFANBWMIDEI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |