C16H22N4O5S — CID 112991821
4-(dimethylsulfamoyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]benzamide (PubChem CID 112991821) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 112991821 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCC(=O)N2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C16H22N4O5S/c1-18(2)26(24,25)14-5-3-13(4-6-14)16(23)17-11-15(22)20-9-7-19(12-21)8-10-20/h3-6,12H,7-11H2,1-2H3,(H,17,23) |
| InChIKey | JUCXZFIVYCGJDD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|