C15H22BrN3O3S — CID 6459628
4-bromo-N-ethyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 6459628) has the molecular formula C15H22BrN3O3S and a molecular weight of 404.33 g/mol. Its IUPAC name is 4-bromo-N-ethyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | 4-bromo-N-ethyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6459628 |
| Molecular Formula | C15H22BrN3O3S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 4-bromo-N-ethyl-N-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | CCN(CC(=O)N1CCN(C)CC1)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H22BrN3O3S/c1-3-19(12-15(20)18-10-8-17(2)9-11-18)23(21,22)14-6-4-13(16)5-7-14/h4-7H,3,8-12H2,1-2H3 |
| InChIKey | CRVPPSDHEDSQME-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |