C15H23FN3O3S+ — CID 7263424
N-ethyl-4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 7263424) has the molecular formula C15H23FN3O3S+ and a molecular weight of 344.43 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-ethyl-4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7263424 |
| Molecular Formula | C15H23FN3O3S+ |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-ethyl-4-fluoro-N-[2-(4-methylpiperazin-4-ium-1-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | CCN(CC(=O)N1CC[NH+](C)CC1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FN3O3S/c1-3-19(12-15(20)18-10-8-17(2)9-11-18)23(21,22)14-6-4-13(16)5-7-14/h4-7H,3,8-12H2,1-2H3/p+1 |
| InChIKey | YALNGUDQRRTBEN-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |