C18H28N4O4S — CID 119414247
N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-3-(diethylsulfamoyl)benzamide (PubChem CID 119414247) has the molecular formula C18H28N4O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-3-(diethylsulfamoyl)benzamide.
| Compound Name | N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-3-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 119414247 |
| Molecular Formula | C18H28N4O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-[2-(1,4-diazepan-1-yl)-2-oxoethyl]-3-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)NCC(=O)N2CCCNCC2)c1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-22(4-2)27(25,26)16-8-5-7-15(13-16)18(24)20-14-17(23)21-11-6-9-19-10-12-21/h5,7-8,13,19H,3-4,6,9-12,14H2,1-2H3,(H,20,24) |
| InChIKey | ZENDKYCDRMIGKK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |