C21H24FN3O6S — CID 55303991
[2-(3-fluoroanilino)-2-oxoethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 55303991) has the molecular formula C21H24FN3O6S and a molecular weight of 465.50 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55303991 |
| Molecular Formula | C21H24FN3O6S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)OCC(=O)Nc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C21H24FN3O6S/c1-3-25(4-2)32(29,30)18-10-8-15(9-11-18)21(28)23-13-20(27)31-14-19(26)24-17-7-5-6-16(22)12-17/h5-12H,3-4,13-14H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | XUUDWIZEQVDFAU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |