C17H16FN3O6S — CID 29155285
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 29155285) has the molecular formula C17H16FN3O6S and a molecular weight of 409.40 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 29155285 |
| Molecular Formula | C17H16FN3O6S |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COC(=O)CNC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H16FN3O6S/c18-12-4-1-3-11(7-12)17(24)20-9-16(23)27-10-15(22)21-13-5-2-6-14(8-13)28(19,25)26/h1-8H,9-10H2,(H,20,24)(H,21,22)(H2,19,25,26) |
| InChIKey | WTLCVGBGJXNQLQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |