C20H23N3O7S2 — CID 55356749
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 55356749) has the molecular formula C20H23N3O7S2 and a molecular weight of 481.55 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55356749 |
| Molecular Formula | C20H23N3O7S2 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)OCC(=O)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H23N3O7S2/c1-3-23(4-2)32(28,29)15-9-7-14(8-10-15)19(26)21-12-18(25)30-13-17(24)22-20(27)16-6-5-11-31-16/h5-11H,3-4,12-13H2,1-2H3,(H,21,26)(H,22,24,27) |
| InChIKey | ACXRRTNOYJVJBL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |