C16H19ClN4O5S2 — CID 55419195
(5-chlorothiadiazol-4-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 55419195) has the molecular formula C16H19ClN4O5S2 and a molecular weight of 446.94 g/mol. Its IUPAC name is (5-chlorothiadiazol-4-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | (5-chlorothiadiazol-4-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55419195 |
| Molecular Formula | C16H19ClN4O5S2 |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | (5-chlorothiadiazol-4-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)OCc2nnsc2Cl)cc1 |
| InChI | InChI=1S/C16H19ClN4O5S2/c1-3-21(4-2)28(24,25)12-7-5-11(6-8-12)16(23)18-9-14(22)26-10-13-15(17)27-20-19-13/h5-8H,3-4,9-10H2,1-2H3,(H,18,23) |
| InChIKey | DBNJRHJNZVTLNJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |