C23H25N3O6S — CID 55474493
(3-phenyl-1,2-oxazol-5-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate (PubChem CID 55474493) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55474493 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-[[4-(diethylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NCC(=O)OCc2cc(-c3ccccc3)no2)cc1 |
| InChI | InChI=1S/C23H25N3O6S/c1-3-26(4-2)33(29,30)20-12-10-18(11-13-20)23(28)24-15-22(27)31-16-19-14-21(25-32-19)17-8-6-5-7-9-17/h5-14H,3-4,15-16H2,1-2H3,(H,24,28) |
| InChIKey | BUMSAHAPQCDKTD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |