C22H27Cl2N5O4S2 — CID 45133606
N-[2-[2-[(2,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dipropylsulfamoyl)benzamide (PubChem CID 45133606) has the molecular formula C22H27Cl2N5O4S2 and a molecular weight of 560.53 g/mol. Its IUPAC name is N-[2-[2-[(2,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dipropylsulfamoyl)benzamide.
| Compound Name | N-[2-[2-[(2,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dipropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 45133606 |
| Molecular Formula | C22H27Cl2N5O4S2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 559.09 |
| IUPAC Name | N-[2-[2-[(2,4-dichlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dipropylsulfamoyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)NCC(=O)NNC(=S)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H27Cl2N5O4S2/c1-3-11-29(12-4-2)35(32,33)17-8-5-15(6-9-17)21(31)25-14-20(30)27-28-22(34)26-19-10-7-16(23)13-18(19)24/h5-10,13H,3-4,11-12,14H2,1-2H3,(H,25,31)(H,27,30)(H2,26,28,34) |
| InChIKey | YRNATONGEDNWGR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|