C18H20ClN5O4S2 — CID 43948666
N-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide (PubChem CID 43948666) has the molecular formula C18H20ClN5O4S2 and a molecular weight of 469.98 g/mol. Its IUPAC name is N-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43948666 |
| Molecular Formula | C18H20ClN5O4S2 |
| Molecular Weight | 469.98 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[2-[2-[(3-chlorophenyl)carbamothioyl]hydrazinyl]-2-oxoethyl]-4-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NCC(=O)NNC(=S)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20ClN5O4S2/c1-24(2)30(27,28)15-8-6-12(7-9-15)17(26)20-11-16(25)22-23-18(29)21-14-5-3-4-13(19)10-14/h3-10H,11H2,1-2H3,(H,20,26)(H,22,25)(H2,21,23,29) |
| InChIKey | NRVKFDUAKKTEGU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.98 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|