C15H25N5O2S3 — CID 8655058
1-[3-(dimethylsulfamoyl)phenyl]-3-(pentylcarbamothioylamino)thiourea (PubChem CID 8655058) has the molecular formula C15H25N5O2S3 and a molecular weight of 403.60 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(pentylcarbamothioylamino)thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(pentylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8655058 |
| Molecular Formula | C15H25N5O2S3 |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(pentylcarbamothioylamino)thiourea |
| SMILES | CCCCCNC(=S)NNC(=S)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H25N5O2S3/c1-4-5-6-10-16-14(23)18-19-15(24)17-12-8-7-9-13(11-12)25(21,22)20(2)3/h7-9,11H,4-6,10H2,1-3H3,(H2,16,18,23)(H2,17,19,24) |
| InChIKey | YDAXFCCACANAFV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|