C25H28N4O3S — CID 3597493
4-(dipropylsulfamoyl)-N-(4-phenyldiazenylphenyl)benzamide (PubChem CID 3597493) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-(dipropylsulfamoyl)-N-(4-phenyldiazenylphenyl)benzamide.
| Compound Name | 4-(dipropylsulfamoyl)-N-(4-phenyldiazenylphenyl)benzamide |
|---|---|
| PubChem CID | 3597493 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-(dipropylsulfamoyl)-N-(4-phenyldiazenylphenyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2ccc(/N=N/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-3-18-29(19-4-2)33(31,32)24-16-10-20(11-17-24)25(30)26-21-12-14-23(15-13-21)28-27-22-8-6-5-7-9-22/h5-17H,3-4,18-19H2,1-2H3,(H,26,30)/b28-27+ |
| InChIKey | OVWVPIOHDHHHGH-BYYHNAKLSA-N |
| XLogP | 6.16 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|