C22H28N4O4S — CID 2803391
N-[(4-acetamidophenyl)methylideneamino]-4-(dipropylsulfamoyl)benzamide (PubChem CID 2803391) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-[(4-acetamidophenyl)methylideneamino]-4-(dipropylsulfamoyl)benzamide.
| Compound Name | N-[(4-acetamidophenyl)methylideneamino]-4-(dipropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2803391 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[(4-acetamidophenyl)methylideneamino]-4-(dipropylsulfamoyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)NN=Cc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C22H28N4O4S/c1-4-14-26(15-5-2)31(29,30)21-12-8-19(9-13-21)22(28)25-23-16-18-6-10-20(11-7-18)24-17(3)27/h6-13,16H,4-5,14-15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | SALKUBNASUHODZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|