C22H19N5O2 — CID 170647561
4-acetamido-N-[(E)-(4-phenyldiazenylphenyl)methylideneamino]benzamide (PubChem CID 170647561) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 4-acetamido-N-[(E)-(4-phenyldiazenylphenyl)methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(E)-(4-phenyldiazenylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 170647561 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-acetamido-N-[(E)-(4-phenyldiazenylphenyl)methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)N/N=C/c2ccc(/N=N/c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H19N5O2/c1-16(28)24-19-13-9-18(10-14-19)22(29)27-23-15-17-7-11-21(12-8-17)26-25-20-5-3-2-4-6-20/h2-15H,1H3,(H,24,28)(H,27,29)/b23-15+,26-25+ |
| InChIKey | ABCMHIDUZISTMS-JHXFIANCSA-N |
| XLogP | 4.82 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|