C23H20BrN3O3 — CID 4644510
4-acetamido-N-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]benzamide (PubChem CID 4644510) has the molecular formula C23H20BrN3O3 and a molecular weight of 466.34 g/mol. Its IUPAC name is 4-acetamido-N-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-acetamido-N-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4644510 |
| Molecular Formula | C23H20BrN3O3 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-acetamido-N-[(3-bromo-4-phenylmethoxyphenyl)methylideneamino]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NN=Cc2ccc(OCc3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H20BrN3O3/c1-16(28)26-20-10-8-19(9-11-20)23(29)27-25-14-18-7-12-22(21(24)13-18)30-15-17-5-3-2-4-6-17/h2-14H,15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | ATQKIUDFLMULJX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|