C20H16N4O7S — CID 4928896
N-[4-(benzylsulfamoyl)phenyl]-3,5-dinitrobenzamide (PubChem CID 4928896) has the molecular formula C20H16N4O7S and a molecular weight of 456.44 g/mol. Its IUPAC name is N-[4-(benzylsulfamoyl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(benzylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4928896 |
| Molecular Formula | C20H16N4O7S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[4-(benzylsulfamoyl)phenyl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N4O7S/c25-20(15-10-17(23(26)27)12-18(11-15)24(28)29)22-16-6-8-19(9-7-16)32(30,31)21-13-14-4-2-1-3-5-14/h1-12,21H,13H2,(H,22,25) |
| InChIKey | ZEIWYDQROADDRE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 161.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|