C26H22N2O3S — CID 46385849
4-[4-(benzylsulfamoyl)phenyl]-N-phenylbenzamide (PubChem CID 46385849) has the molecular formula C26H22N2O3S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[4-(benzylsulfamoyl)phenyl]-N-phenylbenzamide.
| Compound Name | 4-[4-(benzylsulfamoyl)phenyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 46385849 |
| Molecular Formula | C26H22N2O3S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 4-[4-(benzylsulfamoyl)phenyl]-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2ccc(S(=O)(=O)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O3S/c29-26(28-24-9-5-2-6-10-24)23-13-11-21(12-14-23)22-15-17-25(18-16-22)32(30,31)27-19-20-7-3-1-4-8-20/h1-18,27H,19H2,(H,28,29) |
| InChIKey | XFQKJPMIQHHDNI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |