C25H21N3O4S — CID 70661029
4-[[[4-(4-hydroxyphenyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide (PubChem CID 70661029) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[[[4-(4-hydroxyphenyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 4-[[[4-(4-hydroxyphenyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 70661029 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[[[4-(4-hydroxyphenyl)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1ccc(CNS(=O)(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O4S/c29-23-11-7-19(8-12-23)20-9-13-24(14-10-20)33(31,32)27-16-18-3-5-21(6-4-18)25(30)28-22-2-1-15-26-17-22/h1-15,17,27,29H,16H2,(H,28,30) |
| InChIKey | GOAABUAJJYTYHY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |