C22H20N4O4S — CID 50912860
4-[[[3-(prop-2-enoylamino)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide (PubChem CID 50912860) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 4-[[[3-(prop-2-enoylamino)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide.
| Compound Name | 4-[[[3-(prop-2-enoylamino)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 50912860 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[[[3-(prop-2-enoylamino)phenyl]sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| SMILES | C=CC(=O)Nc1cccc(S(=O)(=O)NCc2ccc(C(=O)Nc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C22H20N4O4S/c1-2-21(27)25-18-5-3-7-20(13-18)31(29,30)24-14-16-8-10-17(11-9-16)22(28)26-19-6-4-12-23-15-19/h2-13,15,24H,1,14H2,(H,25,27)(H,26,28) |
| InChIKey | LFEDWIOWWNXJLA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|