C19H15Cl2N3O3S — CID 2564609
N-(3,4-dichlorophenyl)-3-(pyridin-3-ylmethylsulfamoyl)benzamide (PubChem CID 2564609) has the molecular formula C19H15Cl2N3O3S and a molecular weight of 436.32 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-3-(pyridin-3-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(3,4-dichlorophenyl)-3-(pyridin-3-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 2564609 |
| Molecular Formula | C19H15Cl2N3O3S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | N-(3,4-dichlorophenyl)-3-(pyridin-3-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cccc(S(=O)(=O)NCc2cccnc2)c1 |
| InChI | InChI=1S/C19H15Cl2N3O3S/c20-17-7-6-15(10-18(17)21)24-19(25)14-4-1-5-16(9-14)28(26,27)23-12-13-3-2-8-22-11-13/h1-11,23H,12H2,(H,24,25) |
| InChIKey | CFQPOFALRDIOHO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |