C26H23N3O3S2 — CID 34424924
3-(benzylsulfamoyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]benzamide (PubChem CID 34424924) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 34424924 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C26H23N3O3S2/c30-26(29-23-11-13-24(14-12-23)33-19-21-8-5-15-27-17-21)22-9-4-10-25(16-22)34(31,32)28-18-20-6-2-1-3-7-20/h1-17,28H,18-19H2,(H,29,30) |
| InChIKey | JHCLHEUUPKVBQY-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |