C26H18N2O2S — CID 24620063
9-oxo-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]fluorene-2-carboxamide (PubChem CID 24620063) has the molecular formula C26H18N2O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is 9-oxo-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]fluorene-2-carboxamide.
| Compound Name | 9-oxo-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]fluorene-2-carboxamide |
|---|---|
| PubChem CID | 24620063 |
| Molecular Formula | C26H18N2O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 9-oxo-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]fluorene-2-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C26H18N2O2S/c29-25-23-6-2-1-5-21(23)22-12-7-18(14-24(22)25)26(30)28-19-8-10-20(11-9-19)31-16-17-4-3-13-27-15-17/h1-15H,16H2,(H,28,30) |
| InChIKey | IQHYEDWGXFIKMG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |