C22H18N4OS — CID 36542645
3-phenyl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]imidazole-4-carboxamide (PubChem CID 36542645) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is 3-phenyl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]imidazole-4-carboxamide.
| Compound Name | 3-phenyl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 36542645 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-phenyl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]imidazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C22H18N4OS/c27-22(21-14-24-16-26(21)19-6-2-1-3-7-19)25-18-8-10-20(11-9-18)28-15-17-5-4-12-23-13-17/h1-14,16H,15H2,(H,25,27) |
| InChIKey | LKUZLRLCXWPNRO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |