C23H24N2OS — CID 167600345
(2S)-N-(4-benzylsulfanylphenyl)-2-(pyridin-3-ylmethyl)butanamide (PubChem CID 167600345) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is (2S)-N-(4-benzylsulfanylphenyl)-2-(pyridin-3-ylmethyl)butanamide.
| Compound Name | (2S)-N-(4-benzylsulfanylphenyl)-2-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 167600345 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (2S)-N-(4-benzylsulfanylphenyl)-2-(pyridin-3-ylmethyl)butanamide |
| SMILES | CC[C@@H](Cc1cccnc1)C(=O)Nc1ccc(SCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2OS/c1-2-20(15-19-9-6-14-24-16-19)23(26)25-21-10-12-22(13-11-21)27-17-18-7-4-3-5-8-18/h3-14,16,20H,2,15,17H2,1H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | YSRWKLSJVZWCJL-FQEVSTJZSA-N |
| XLogP | 5.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |