C27H20N4OS — CID 46668985
2-pyridin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]quinoline-4-carboxamide (PubChem CID 46668985) has the molecular formula C27H20N4OS and a molecular weight of 448.55 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-pyridin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46668985 |
| Molecular Formula | C27H20N4OS |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-pyridin-3-yl-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C27H20N4OS/c32-27(30-21-9-11-22(12-10-21)33-18-19-5-3-13-28-16-19)24-15-26(20-6-4-14-29-17-20)31-25-8-2-1-7-23(24)25/h1-17H,18H2,(H,30,32) |
| InChIKey | WFJHLUYHNWRNFQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |