C24H20N2O4S2 — CID 46672069
3-(benzenesulfonylmethyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]furan-2-carboxamide (PubChem CID 46672069) has the molecular formula C24H20N2O4S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]furan-2-carboxamide.
| Compound Name | 3-(benzenesulfonylmethyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46672069 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(SCc2cccnc2)cc1)c1occc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O4S2/c27-24(23-19(12-14-30-23)17-32(28,29)22-6-2-1-3-7-22)26-20-8-10-21(11-9-20)31-16-18-5-4-13-25-15-18/h1-15H,16-17H2,(H,26,27) |
| InChIKey | MRPXLBNNPYPUGZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |