C25H22N2O4S — CID 78863795
N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide (PubChem CID 78863795) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78863795 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2occc2CSc2ccccc2)cc1OCc1cccnc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-29-22-10-9-20(14-23(22)31-16-18-6-5-12-26-15-18)27-25(28)24-19(11-13-30-24)17-32-21-7-3-2-4-8-21/h2-15H,16-17H2,1H3,(H,27,28) |
| InChIKey | RSMQCFBICATSHN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |