C24H19N3O3S — CID 78861185
N-[3-[[3-(phenylsulfanylmethyl)furan-2-carbonyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 78861185) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[3-[[3-(phenylsulfanylmethyl)furan-2-carbonyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[3-(phenylsulfanylmethyl)furan-2-carbonyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 78861185 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-[3-[[3-(phenylsulfanylmethyl)furan-2-carbonyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc(NC(=O)c2occc2CSc2ccccc2)c1)c1ccncc1 |
| InChI | InChI=1S/C24H19N3O3S/c28-23(17-9-12-25-13-10-17)26-19-5-4-6-20(15-19)27-24(29)22-18(11-14-30-22)16-31-21-7-2-1-3-8-21/h1-15H,16H2,(H,26,28)(H,27,29) |
| InChIKey | NZSCRKMRNQRFOJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |