C24H21NO4S — CID 78891799
N-[3-(furan-2-ylmethoxymethyl)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide (PubChem CID 78891799) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethoxymethyl)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-[3-(furan-2-ylmethoxymethyl)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78891799 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[3-(furan-2-ylmethoxymethyl)phenyl]-3-(phenylsulfanylmethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(COCc2ccco2)c1)c1occc1CSc1ccccc1 |
| InChI | InChI=1S/C24H21NO4S/c26-24(23-19(11-13-29-23)17-30-22-9-2-1-3-10-22)25-20-7-4-6-18(14-20)15-27-16-21-8-5-12-28-21/h1-14H,15-17H2,(H,25,26) |
| InChIKey | ZEOYKJNORNMNSS-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |