C24H21NO6S — CID 55807041
5-(benzenesulfonylmethyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]furan-2-carboxamide (PubChem CID 55807041) has the molecular formula C24H21NO6S and a molecular weight of 451.50 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55807041 |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[3-(furan-2-ylmethoxymethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(COCc2ccco2)c1)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C24H21NO6S/c26-24(23-12-11-21(31-23)17-32(27,28)22-9-2-1-3-10-22)25-19-7-4-6-18(14-19)15-29-16-20-8-5-13-30-20/h1-14H,15-17H2,(H,25,26) |
| InChIKey | QVTLGGOTTGRWFD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |