C15H14F3NO3 — CID 47048652
3,3,3-trifluoro-N-[3-(furan-2-ylmethoxymethyl)phenyl]propanamide (PubChem CID 47048652) has the molecular formula C15H14F3NO3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-(furan-2-ylmethoxymethyl)phenyl]propanamide.
| Compound Name | 3,3,3-trifluoro-N-[3-(furan-2-ylmethoxymethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 47048652 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-(furan-2-ylmethoxymethyl)phenyl]propanamide |
| SMILES | O=C(CC(F)(F)F)Nc1cccc(COCc2ccco2)c1 |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)8-14(20)19-12-4-1-3-11(7-12)9-21-10-13-5-2-6-22-13/h1-7H,8-10H2,(H,19,20) |
| InChIKey | GYUZGHBFLZGRPH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |