C25H22N2O6 — CID 55933693
N-[3-[2-[3-(furan-2-ylmethoxymethyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55933693) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is N-[3-[2-[3-(furan-2-ylmethoxymethyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[3-(furan-2-ylmethoxymethyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55933693 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-[3-[2-[3-(furan-2-ylmethoxymethyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccco2)c1)Nc1cccc(COCc2ccco2)c1 |
| InChI | InChI=1S/C25H22N2O6/c28-24(26-19-6-1-5-18(13-19)15-30-16-22-9-3-11-31-22)17-33-21-8-2-7-20(14-21)27-25(29)23-10-4-12-32-23/h1-14H,15-17H2,(H,26,28)(H,27,29) |
| InChIKey | PICINARWLRXKBB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |