C19H14Cl2N2O4 — CID 37026412
N-[3-[[2-(3,4-dichlorophenoxy)acetyl]amino]phenyl]furan-2-carboxamide (PubChem CID 37026412) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is N-[3-[[2-(3,4-dichlorophenoxy)acetyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[2-(3,4-dichlorophenoxy)acetyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 37026412 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | N-[3-[[2-(3,4-dichlorophenoxy)acetyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)c(Cl)c1)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C19H14Cl2N2O4/c20-15-7-6-14(10-16(15)21)27-11-18(24)22-12-3-1-4-13(9-12)23-19(25)17-5-2-8-26-17/h1-10H,11H2,(H,22,24)(H,23,25) |
| InChIKey | DWWYFYPIKOAUMX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |