C25H25N3O5 — CID 55959108
N-[3-[2-[4-(cyclopentylcarbamoyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide (PubChem CID 55959108) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-[3-[2-[4-(cyclopentylcarbamoyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-[4-(cyclopentylcarbamoyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55959108 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[3-[2-[4-(cyclopentylcarbamoyl)anilino]-2-oxoethoxy]phenyl]furan-2-carboxamide |
| SMILES | O=C(COc1cccc(NC(=O)c2ccco2)c1)Nc1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c29-23(26-19-12-10-17(11-13-19)24(30)27-18-5-1-2-6-18)16-33-21-8-3-7-20(15-21)28-25(31)22-9-4-14-32-22/h3-4,7-15,18H,1-2,5-6,16H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | VREUASOXYFPHNU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |